C13H15NO2S — CID 174948003
tert-butyl N-cyclopenta[b]thiopyran-6-ylcarbamate (PubChem CID 174948003) has the molecular formula C13H15NO2S and a molecular weight of 249.34 g/mol. Its IUPAC name is tert-butyl N-cyclopenta[b]thiopyran-6-ylcarbamate.
| Compound Name | tert-butyl N-cyclopenta[b]thiopyran-6-ylcarbamate |
|---|---|
| PubChem CID | 174948003 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | tert-butyl N-cyclopenta[b]thiopyran-6-ylcarbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc2cccsc-2c1 |
| InChI | InChI=1S/C13H15NO2S/c1-13(2,3)16-12(15)14-10-7-9-5-4-6-17-11(9)8-10/h4-8H,1-3H3,(H,14,15) |
| InChIKey | CGCMCHODBRLDMZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |