C15H17NO2S — CID 7176355
tert-butyl N-(3-thiophen-3-ylphenyl)carbamate (PubChem CID 7176355) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is tert-butyl N-(3-thiophen-3-ylphenyl)carbamate.
| Compound Name | tert-butyl N-(3-thiophen-3-ylphenyl)carbamate |
|---|---|
| PubChem CID | 7176355 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | tert-butyl N-(3-thiophen-3-ylphenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(-c2ccsc2)c1 |
| InChI | InChI=1S/C15H17NO2S/c1-15(2,3)18-14(17)16-13-6-4-5-11(9-13)12-7-8-19-10-12/h4-10H,1-3H3,(H,16,17) |
| InChIKey | RUOWCNTWJRAGIM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |