C19H24N2O2S — CID 143559695
tert-butyl N-[2-[[(E)-but-2-enyl]amino]-4-thiophen-2-ylphenyl]carbamate (PubChem CID 143559695) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is tert-butyl N-[2-[[(E)-but-2-enyl]amino]-4-thiophen-2-ylphenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(E)-but-2-enyl]amino]-4-thiophen-2-ylphenyl]carbamate |
|---|---|
| PubChem CID | 143559695 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | tert-butyl N-[2-[[(E)-but-2-enyl]amino]-4-thiophen-2-ylphenyl]carbamate |
| SMILES | C/C=C/CNc1cc(-c2cccs2)ccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H24N2O2S/c1-5-6-11-20-16-13-14(17-8-7-12-24-17)9-10-15(16)21-18(22)23-19(2,3)4/h5-10,12-13,20H,11H2,1-4H3,(H,21,22)/b6-5+ |
| InChIKey | PLYGZHJAKLAVOB-AATRIKPKSA-N |
| XLogP | 5.75 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|