C30H31N5O3S — CID 118701005
tert-butyl N-[2-[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]-4-thiophen-2-ylphenyl]carbamate (PubChem CID 118701005) has the molecular formula C30H31N5O3S and a molecular weight of 541.68 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]-4-thiophen-2-ylphenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]-4-thiophen-2-ylphenyl]carbamate |
|---|---|
| PubChem CID | 118701005 |
| Molecular Formula | C30H31N5O3S |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | tert-butyl N-[2-[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]-4-thiophen-2-ylphenyl]carbamate |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(C(=O)Nc3cc(-c4cccs4)ccc3NC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H31N5O3S/c1-30(2,3)38-29(37)32-25-17-10-21(27-7-6-18-39-27)19-26(25)31-28(36)20-8-11-22(12-9-20)33-34-23-13-15-24(16-14-23)35(4)5/h6-19H,1-5H3,(H,31,36)(H,32,37)/b34-33+ |
| InChIKey | OSZWKBGJNWMSJC-JEIPZWNWSA-N |
| XLogP | 8.50 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|