C29H34N5O4S+ — CID 170452237
tert-butyl N-[2-[[1-(2-morpholin-4-ylethyl)-3H-benzimidazol-1-ium-5-carbonyl]amino]-4-thiophen-2-ylphenyl]carbamate (PubChem CID 170452237) has the molecular formula C29H34N5O4S+ and a molecular weight of 548.69 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-(2-morpholin-4-ylethyl)-3H-benzimidazol-1-ium-5-carbonyl]amino]-4-thiophen-2-ylphenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-(2-morpholin-4-ylethyl)-3H-benzimidazol-1-ium-5-carbonyl]amino]-4-thiophen-2-ylphenyl]carbamate |
|---|---|
| PubChem CID | 170452237 |
| Molecular Formula | C29H34N5O4S+ |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | tert-butyl N-[2-[[1-(2-morpholin-4-ylethyl)-3H-benzimidazol-1-ium-5-carbonyl]amino]-4-thiophen-2-ylphenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc2c(c1)[nH]c[n+]2CCN1CCOCC1 |
| InChI | InChI=1S/C29H33N5O4S/c1-29(2,3)38-28(36)32-22-8-6-20(26-5-4-16-39-26)17-23(22)31-27(35)21-7-9-25-24(18-21)30-19-34(25)11-10-33-12-14-37-15-13-33/h4-9,16-19H,10-15H2,1-3H3,(H2,31,32,35,36)/p+1 |
| InChIKey | HEDCSXZPXSFQPL-UHFFFAOYSA-O |
| XLogP | 5.12 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|