C33H41N3O2S — CID 144995732
N-(2-amino-5-thiophen-2-ylphenyl)-3-[(E)-2-cyclopropyl-4-ethyl-6-morpholin-4-ylhex-1-enyl]-4-methylbenzamide (PubChem CID 144995732) has the molecular formula C33H41N3O2S and a molecular weight of 543.78 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-3-[(E)-2-cyclopropyl-4-ethyl-6-morpholin-4-ylhex-1-enyl]-4-methylbenzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-3-[(E)-2-cyclopropyl-4-ethyl-6-morpholin-4-ylhex-1-enyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 144995732 |
| Molecular Formula | C33H41N3O2S |
| Molecular Weight | 543.78 g/mol |
| Exact Mass | 543.29 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-3-[(E)-2-cyclopropyl-4-ethyl-6-morpholin-4-ylhex-1-enyl]-4-methylbenzamide |
| SMILES | CCC(CCN1CCOCC1)C/C(=C\c1cc(C(=O)Nc2cc(-c3cccs3)ccc2N)ccc1C)C1CC1 |
| InChI | InChI=1S/C33H41N3O2S/c1-3-24(12-13-36-14-16-38-17-15-36)19-29(25-8-9-25)21-28-20-27(7-6-23(28)2)33(37)35-31-22-26(10-11-30(31)34)32-5-4-18-39-32/h4-7,10-11,18,20-22,24-25H,3,8-9,12-17,19,34H2,1-2H3,(H,35,37)/b29-21+ |
| InChIKey | UFPFCUISWGDZDX-XHLNEMQHSA-N |
| XLogP | 7.49 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.78 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|