C33H37N5O2S — CID 143559636
tert-butyl N-[2-[1-[4-[4-(pyridin-4-ylmethyl)piperazin-1-yl]phenyl]ethenylamino]-4-thiophen-2-ylphenyl]carbamate (PubChem CID 143559636) has the molecular formula C33H37N5O2S and a molecular weight of 567.76 g/mol. Its IUPAC name is tert-butyl N-[2-[1-[4-[4-(pyridin-4-ylmethyl)piperazin-1-yl]phenyl]ethenylamino]-4-thiophen-2-ylphenyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-[4-[4-(pyridin-4-ylmethyl)piperazin-1-yl]phenyl]ethenylamino]-4-thiophen-2-ylphenyl]carbamate |
|---|---|
| PubChem CID | 143559636 |
| Molecular Formula | C33H37N5O2S |
| Molecular Weight | 567.76 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | tert-butyl N-[2-[1-[4-[4-(pyridin-4-ylmethyl)piperazin-1-yl]phenyl]ethenylamino]-4-thiophen-2-ylphenyl]carbamate |
| SMILES | C=C(Nc1cc(-c2cccs2)ccc1NC(=O)OC(C)(C)C)c1ccc(N2CCN(Cc3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C33H37N5O2S/c1-24(26-7-10-28(11-8-26)38-19-17-37(18-20-38)23-25-13-15-34-16-14-25)35-30-22-27(31-6-5-21-41-31)9-12-29(30)36-32(39)40-33(2,3)4/h5-16,21-22,35H,1,17-20,23H2,2-4H3,(H,36,39) |
| InChIKey | GRAZIMACXAKCMM-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.76 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|