C36H45ClN4O8S2 — CID 157328097
tert-butyl N-(2-amino-4-thiophen-2-ylphenyl)carbamate;tert-butyl N-[2-(ethoxycarbonylamino)-4-thiophen-2-ylphenyl]carbamate;ethyl carbonochloridate (PubChem CID 157328097) has the molecular formula C36H45ClN4O8S2 and a molecular weight of 761.36 g/mol. Its IUPAC name is tert-butyl N-(2-amino-4-thiophen-2-ylphenyl)carbamate;tert-butyl N-[2-(ethoxycarbonylamino)-4-thiophen-2-ylphenyl]carbamate;ethyl carbonochloridate.
| Compound Name | tert-butyl N-(2-amino-4-thiophen-2-ylphenyl)carbamate;tert-butyl N-[2-(ethoxycarbonylamino)-4-thiophen-2-ylphenyl]carbamate;ethyl carbonochloridate |
|---|---|
| PubChem CID | 157328097 |
| Molecular Formula | C36H45ClN4O8S2 |
| Molecular Weight | 761.36 g/mol |
| Exact Mass | 760.24 |
| IUPAC Name | tert-butyl N-(2-amino-4-thiophen-2-ylphenyl)carbamate;tert-butyl N-[2-(ethoxycarbonylamino)-4-thiophen-2-ylphenyl]carbamate;ethyl carbonochloridate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-c2cccs2)cc1N.CCOC(=O)Cl.CCOC(=O)Nc1cc(-c2cccs2)ccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H22N2O4S.C15H18N2O2S.C3H5ClO2/c1-5-23-16(21)20-14-11-12(15-7-6-10-25-15)8-9-13(14)19-17(22)24-18(2,3)4;1-15(2,3)19-14(18)17-12-7-6-10(9-11(12)16)13-5-4-8-20-13;1-2-6-3(4)5/h6-11H,5H2,1-4H3,(H,19,22)(H,20,21);4-9H,16H2,1-3H3,(H,17,18);2H2,1H3 |
| InChIKey | BEYRBSRGHRTUOK-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 167.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.36 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|