C19H20N4O2S — CID 137420884
ethyl N-[2-amino-6-[(4-thiophen-2-ylphenyl)methylamino]-3-pyridinyl]carbamate (PubChem CID 137420884) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is ethyl N-[2-amino-6-[(4-thiophen-2-ylphenyl)methylamino]-3-pyridinyl]carbamate.
| Compound Name | ethyl N-[2-amino-6-[(4-thiophen-2-ylphenyl)methylamino]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 137420884 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | ethyl N-[2-amino-6-[(4-thiophen-2-ylphenyl)methylamino]-3-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NCc2ccc(-c3cccs3)cc2)nc1N |
| InChI | InChI=1S/C19H20N4O2S/c1-2-25-19(24)22-15-9-10-17(23-18(15)20)21-12-13-5-7-14(8-6-13)16-4-3-11-26-16/h3-11H,2,12H2,1H3,(H,22,24)(H3,20,21,23) |
| InChIKey | YAXGLAJACTWKEQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |