C16H20FN4O5S- — CID 131740296
ethyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate;methanesulfonate (PubChem CID 131740296) has the molecular formula C16H20FN4O5S- and a molecular weight of 399.42 g/mol. Its IUPAC name is ethyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate;methanesulfonate.
| Compound Name | ethyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate;methanesulfonate |
|---|---|
| PubChem CID | 131740296 |
| Molecular Formula | C16H20FN4O5S- |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | ethyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate;methanesulfonate |
| SMILES | CCOC(=O)Nc1ccc(NCc2ccc(F)cc2)nc1N.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C15H17FN4O2.CH4O3S/c1-2-22-15(21)19-12-7-8-13(20-14(12)17)18-9-10-3-5-11(16)6-4-10;1-5(2,3)4/h3-8H,2,9H2,1H3,(H,19,21)(H3,17,18,20);1H3,(H,2,3,4)/p-1 |
| InChIKey | AXGQMIUIFRSMRG-UHFFFAOYSA-M |
| XLogP | 2.14 |
| TPSA | 146.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|