C15H16FN3O2 — CID 141275396
ethyl N-[2-amino-6-[(4-fluorophenyl)methyl]-3-pyridinyl]carbamate (PubChem CID 141275396) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is ethyl N-[2-amino-6-[(4-fluorophenyl)methyl]-3-pyridinyl]carbamate.
| Compound Name | ethyl N-[2-amino-6-[(4-fluorophenyl)methyl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 141275396 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | ethyl N-[2-amino-6-[(4-fluorophenyl)methyl]-3-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(Cc2ccc(F)cc2)nc1N |
| InChI | InChI=1S/C15H16FN3O2/c1-2-21-15(20)19-13-8-7-12(18-14(13)17)9-10-3-5-11(16)6-4-10/h3-8H,2,9H2,1H3,(H2,17,18)(H,19,20) |
| InChIKey | ZQUJZVFWQWCPPY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |