C16H18FN5O2S — CID 87118898
ethyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate;thiocyanic acid (PubChem CID 87118898) has the molecular formula C16H18FN5O2S and a molecular weight of 363.42 g/mol. Its IUPAC name is ethyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate;thiocyanic acid.
| Compound Name | ethyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate;thiocyanic acid |
|---|---|
| PubChem CID | 87118898 |
| Molecular Formula | C16H18FN5O2S |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | ethyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate;thiocyanic acid |
| SMILES | CCOC(=O)Nc1ccc(NCc2ccc(F)cc2)nc1N.N#CS |
| InChI | InChI=1S/C15H17FN4O2.CHNS/c1-2-22-15(21)19-12-7-8-13(20-14(12)17)18-9-10-3-5-11(16)6-4-10;2-1-3/h3-8H,2,9H2,1H3,(H,19,21)(H3,17,18,20);3H |
| InChIKey | CREXSMQJHRAXED-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|