C15H17Cl2FN4O2 — CID 45261412
2-chloroethyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate;hydrochloride (PubChem CID 45261412) has the molecular formula C15H17Cl2FN4O2 and a molecular weight of 375.23 g/mol. Its IUPAC name is 2-chloroethyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate;hydrochloride.
| Compound Name | 2-chloroethyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 45261412 |
| Molecular Formula | C15H17Cl2FN4O2 |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 2-chloroethyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate;hydrochloride |
| SMILES | Cl.Nc1nc(NCc2ccc(F)cc2)ccc1NC(=O)OCCCl |
| InChI | InChI=1S/C15H16ClFN4O2.ClH/c16-7-8-23-15(22)20-12-5-6-13(21-14(12)18)19-9-10-1-3-11(17)4-2-10;/h1-6H,7-9H2,(H,20,22)(H3,18,19,21);1H |
| InChIKey | DAPXAXGARJYNJT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|