C19H23FN4O2 — CID 110186504
cyclohexyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate (PubChem CID 110186504) has the molecular formula C19H23FN4O2 and a molecular weight of 358.42 g/mol. Its IUPAC name is cyclohexyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate.
| Compound Name | cyclohexyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 110186504 |
| Molecular Formula | C19H23FN4O2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | cyclohexyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate |
| SMILES | Nc1nc(NCc2ccc(F)cc2)ccc1NC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C19H23FN4O2/c20-14-8-6-13(7-9-14)12-22-17-11-10-16(18(21)24-17)23-19(25)26-15-4-2-1-3-5-15/h6-11,15H,1-5,12H2,(H,23,25)(H3,21,22,24) |
| InChIKey | RVPYKMQCMDALNT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |