C19H21FN2O3 — CID 25030692
cyclopentyl N-[2-amino-4-[(4-fluorophenyl)methoxy]phenyl]carbamate (PubChem CID 25030692) has the molecular formula C19H21FN2O3 and a molecular weight of 344.39 g/mol. Its IUPAC name is cyclopentyl N-[2-amino-4-[(4-fluorophenyl)methoxy]phenyl]carbamate.
| Compound Name | cyclopentyl N-[2-amino-4-[(4-fluorophenyl)methoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 25030692 |
| Molecular Formula | C19H21FN2O3 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | cyclopentyl N-[2-amino-4-[(4-fluorophenyl)methoxy]phenyl]carbamate |
| SMILES | Nc1cc(OCc2ccc(F)cc2)ccc1NC(=O)OC1CCCC1 |
| InChI | InChI=1S/C19H21FN2O3/c20-14-7-5-13(6-8-14)12-24-16-9-10-18(17(21)11-16)22-19(23)25-15-3-1-2-4-15/h5-11,15H,1-4,12,21H2,(H,22,23) |
| InChIKey | ZANZWVPQJYDBIO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|