C13H17FN2O2 — CID 112738527
cyclopentyl N-[2-(aminomethyl)-3-fluorophenyl]carbamate (PubChem CID 112738527) has the molecular formula C13H17FN2O2 and a molecular weight of 252.29 g/mol. Its IUPAC name is cyclopentyl N-[2-(aminomethyl)-3-fluorophenyl]carbamate.
| Compound Name | cyclopentyl N-[2-(aminomethyl)-3-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 112738527 |
| Molecular Formula | C13H17FN2O2 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | cyclopentyl N-[2-(aminomethyl)-3-fluorophenyl]carbamate |
| SMILES | NCc1c(F)cccc1NC(=O)OC1CCCC1 |
| InChI | InChI=1S/C13H17FN2O2/c14-11-6-3-7-12(10(11)8-15)16-13(17)18-9-4-1-2-5-9/h3,6-7,9H,1-2,4-5,8,15H2,(H,16,17) |
| InChIKey | BVNKEZQMCCBQJK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |