C14H20N2O3 — CID 79465855
(3-aminocyclohexyl) N-(2-methoxyphenyl)carbamate (PubChem CID 79465855) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is (3-aminocyclohexyl) N-(2-methoxyphenyl)carbamate.
| Compound Name | (3-aminocyclohexyl) N-(2-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 79465855 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (3-aminocyclohexyl) N-(2-methoxyphenyl)carbamate |
| SMILES | COc1ccccc1NC(=O)OC1CCCC(N)C1 |
| InChI | InChI=1S/C14H20N2O3/c1-18-13-8-3-2-7-12(13)16-14(17)19-11-6-4-5-10(15)9-11/h2-3,7-8,10-11H,4-6,9,15H2,1H3,(H,16,17) |
| InChIKey | HPSUXYBFGIMQPU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |