C17H25NO3 — CID 142739719
[(1R,5R)-3,3,5-trimethylcyclohexyl] N-(2-methoxyphenyl)carbamate (PubChem CID 142739719) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is [(1R,5R)-3,3,5-trimethylcyclohexyl] N-(2-methoxyphenyl)carbamate.
| Compound Name | [(1R,5R)-3,3,5-trimethylcyclohexyl] N-(2-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 142739719 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | [(1R,5R)-3,3,5-trimethylcyclohexyl] N-(2-methoxyphenyl)carbamate |
| SMILES | COc1ccccc1NC(=O)O[C@@H]1C[C@H](C)CC(C)(C)C1 |
| InChI | InChI=1S/C17H25NO3/c1-12-9-13(11-17(2,3)10-12)21-16(19)18-14-7-5-6-8-15(14)20-4/h5-8,12-13H,9-11H2,1-4H3,(H,18,19)/t12-,13+/m0/s1 |
| InChIKey | HGESZCQHCAUMMZ-QWHCGFSZSA-N |
| XLogP | 4.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |