C20H29NO3 — CID 156602687
[(3R)-7-propylspiro[3.5]nonan-3-yl] N-(2-methoxyphenyl)carbamate (PubChem CID 156602687) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is [(3R)-7-propylspiro[3.5]nonan-3-yl] N-(2-methoxyphenyl)carbamate.
| Compound Name | [(3R)-7-propylspiro[3.5]nonan-3-yl] N-(2-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 156602687 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | [(3R)-7-propylspiro[3.5]nonan-3-yl] N-(2-methoxyphenyl)carbamate |
| SMILES | CCCC1CCC2(CC1)CC[C@H]2OC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C20H29NO3/c1-3-6-15-9-12-20(13-10-15)14-11-18(20)24-19(22)21-16-7-4-5-8-17(16)23-2/h4-5,7-8,15,18H,3,6,9-14H2,1-2H3,(H,21,22)/t15?,18-,20?/m1/s1 |
| InChIKey | FRMKJUZWSMSVBG-RVSXGSNBSA-N |
| XLogP | 5.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |