C22H26BrFN2O2 — CID 69312195
[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-(3-fluoro-2-phenylphenyl)carbamate bromide (PubChem CID 69312195) has the molecular formula C22H26BrFN2O2 and a molecular weight of 449.36 g/mol. Its IUPAC name is [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-(3-fluoro-2-phenylphenyl)carbamate bromide.
| Compound Name | [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-(3-fluoro-2-phenylphenyl)carbamate bromide |
|---|---|
| PubChem CID | 69312195 |
| Molecular Formula | C22H26BrFN2O2 |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-(3-fluoro-2-phenylphenyl)carbamate bromide |
| SMILES | C[N+]1(C)[C@@H]2CC[C@H]1CC(OC(=O)Nc1cccc(F)c1-c1ccccc1)C2.[Br-] |
| InChI | InChI=1S/C22H25FN2O2.BrH/c1-25(2)16-11-12-17(25)14-18(13-16)27-22(26)24-20-10-6-9-19(23)21(20)15-7-4-3-5-8-15;/h3-10,16-18H,11-14H2,1-2H3;1H/t16-,17+,18?; |
| InChIKey | NKYPRGFZOKNWAU-IESHXZMMSA-N |
| XLogP | 1.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|