C22H25Cl2N2O2+ — CID 11364053
(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) N-[4-chloro-2-(3-chlorophenyl)phenyl]carbamate (PubChem CID 11364053) has the molecular formula C22H25Cl2N2O2+ and a molecular weight of 420.36 g/mol. Its IUPAC name is (8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) N-[4-chloro-2-(3-chlorophenyl)phenyl]carbamate.
| Compound Name | (8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) N-[4-chloro-2-(3-chlorophenyl)phenyl]carbamate |
|---|---|
| PubChem CID | 11364053 |
| Molecular Formula | C22H25Cl2N2O2+ |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | (8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) N-[4-chloro-2-(3-chlorophenyl)phenyl]carbamate |
| SMILES | C[N+]1(C)C2CCC1CC(OC(=O)Nc1ccc(Cl)cc1-c1cccc(Cl)c1)C2 |
| InChI | InChI=1S/C22H24Cl2N2O2/c1-26(2)17-7-8-18(26)13-19(12-17)28-22(27)25-21-9-6-16(24)11-20(21)14-4-3-5-15(23)10-14/h3-6,9-11,17-19H,7-8,12-13H2,1-2H3/p+1 |
| InChIKey | XCHXVFSOZQJPKF-UHFFFAOYSA-O |
| XLogP | 5.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|