C22H25BrClFN2O2 — CID 11363720
(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) N-[2-(3-chlorophenyl)-4-fluorophenyl]carbamate bromide (PubChem CID 11363720) has the molecular formula C22H25BrClFN2O2 and a molecular weight of 483.81 g/mol. Its IUPAC name is (8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) N-[2-(3-chlorophenyl)-4-fluorophenyl]carbamate bromide.
| Compound Name | (8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) N-[2-(3-chlorophenyl)-4-fluorophenyl]carbamate bromide |
|---|---|
| PubChem CID | 11363720 |
| Molecular Formula | C22H25BrClFN2O2 |
| Molecular Weight | 483.81 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | (8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) N-[2-(3-chlorophenyl)-4-fluorophenyl]carbamate bromide |
| SMILES | C[N+]1(C)C2CCC1CC(OC(=O)Nc1ccc(F)cc1-c1cccc(Cl)c1)C2.[Br-] |
| InChI | InChI=1S/C22H24ClFN2O2.BrH/c1-26(2)17-7-8-18(26)13-19(12-17)28-22(27)25-21-9-6-16(24)11-20(21)14-4-3-5-15(23)10-14;/h3-6,9-11,17-19H,7-8,12-13H2,1-2H3;1H |
| InChIKey | CFRXWYLLDMSQNU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.81 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|