C23H28ClN2O2+ — CID 69313620
[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-[2-(3-chlorophenyl)-4-methylphenyl]carbamate (PubChem CID 69313620) has the molecular formula C23H28ClN2O2+ and a molecular weight of 399.94 g/mol. Its IUPAC name is [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-[2-(3-chlorophenyl)-4-methylphenyl]carbamate.
| Compound Name | [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-[2-(3-chlorophenyl)-4-methylphenyl]carbamate |
|---|---|
| PubChem CID | 69313620 |
| Molecular Formula | C23H28ClN2O2+ |
| Molecular Weight | 399.94 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-[2-(3-chlorophenyl)-4-methylphenyl]carbamate |
| SMILES | Cc1ccc(NC(=O)OC2C[C@H]3CC[C@@H](C2)[N+]3(C)C)c(-c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C23H27ClN2O2/c1-15-7-10-22(21(11-15)16-5-4-6-17(24)12-16)25-23(27)28-20-13-18-8-9-19(14-20)26(18,2)3/h4-7,10-12,18-20H,8-9,13-14H2,1-3H3/p+1/t18-,19+,20? |
| InChIKey | KYSXAJRDCDVHNV-YOFSQIOKSA-O |
| XLogP | 5.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.94 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|