C20H25BrN2O2S — CID 11510412
(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) N-(2-thiophen-3-ylphenyl)carbamate bromide (PubChem CID 11510412) has the molecular formula C20H25BrN2O2S and a molecular weight of 437.40 g/mol. Its IUPAC name is (8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) N-(2-thiophen-3-ylphenyl)carbamate bromide.
| Compound Name | (8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) N-(2-thiophen-3-ylphenyl)carbamate bromide |
|---|---|
| PubChem CID | 11510412 |
| Molecular Formula | C20H25BrN2O2S |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | (8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) N-(2-thiophen-3-ylphenyl)carbamate bromide |
| SMILES | C[N+]1(C)C2CCC1CC(OC(=O)Nc1ccccc1-c1ccsc1)C2.[Br-] |
| InChI | InChI=1S/C20H24N2O2S.BrH/c1-22(2)15-7-8-16(22)12-17(11-15)24-20(23)21-19-6-4-3-5-18(19)14-9-10-25-13-14;/h3-6,9-10,13,15-17H,7-8,11-12H2,1-2H3;1H |
| InChIKey | BFIOSPQWKFTKNH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|