C29H34N2O4S — CID 91290302
methyl 2-[4-[4-[4-[(2-thiophen-3-ylphenyl)carbamoyloxy]piperidin-1-yl]butyl]phenyl]acetate (PubChem CID 91290302) has the molecular formula C29H34N2O4S and a molecular weight of 506.67 g/mol. Its IUPAC name is methyl 2-[4-[4-[4-[(2-thiophen-3-ylphenyl)carbamoyloxy]piperidin-1-yl]butyl]phenyl]acetate.
| Compound Name | methyl 2-[4-[4-[4-[(2-thiophen-3-ylphenyl)carbamoyloxy]piperidin-1-yl]butyl]phenyl]acetate |
|---|---|
| PubChem CID | 91290302 |
| Molecular Formula | C29H34N2O4S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | methyl 2-[4-[4-[4-[(2-thiophen-3-ylphenyl)carbamoyloxy]piperidin-1-yl]butyl]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(CCCCN2CCC(OC(=O)Nc3ccccc3-c3ccsc3)CC2)cc1 |
| InChI | InChI=1S/C29H34N2O4S/c1-34-28(32)20-23-11-9-22(10-12-23)6-4-5-16-31-17-13-25(14-18-31)35-29(33)30-27-8-3-2-7-26(27)24-15-19-36-21-24/h2-3,7-12,15,19,21,25H,4-6,13-14,16-18,20H2,1H3,(H,30,33) |
| InChIKey | JPXREXWOBHRZEF-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|