C27H38N2O4S — CID 66811358
[1-[8-(1,3-dioxolan-2-yl)octyl]piperidin-4-yl] N-(2-thiophen-3-ylphenyl)carbamate (PubChem CID 66811358) has the molecular formula C27H38N2O4S and a molecular weight of 486.68 g/mol. Its IUPAC name is [1-[8-(1,3-dioxolan-2-yl)octyl]piperidin-4-yl] N-(2-thiophen-3-ylphenyl)carbamate.
| Compound Name | [1-[8-(1,3-dioxolan-2-yl)octyl]piperidin-4-yl] N-(2-thiophen-3-ylphenyl)carbamate |
|---|---|
| PubChem CID | 66811358 |
| Molecular Formula | C27H38N2O4S |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | [1-[8-(1,3-dioxolan-2-yl)octyl]piperidin-4-yl] N-(2-thiophen-3-ylphenyl)carbamate |
| SMILES | O=C(Nc1ccccc1-c1ccsc1)OC1CCN(CCCCCCCCC2OCCO2)CC1 |
| InChI | InChI=1S/C27H38N2O4S/c30-27(28-25-10-7-6-9-24(25)22-14-20-34-21-22)33-23-12-16-29(17-13-23)15-8-4-2-1-3-5-11-26-31-18-19-32-26/h6-7,9-10,14,20-21,23,26H,1-5,8,11-13,15-19H2,(H,28,30) |
| InChIKey | CAJCSWIAHPHQRQ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|