C23H27ClFN2O2+ — CID 69316039
[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-1-yl]methyl N-[2-(3-chlorophenyl)-4-fluorophenyl]carbamate (PubChem CID 69316039) has the molecular formula C23H27ClFN2O2+ and a molecular weight of 417.93 g/mol. Its IUPAC name is [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-1-yl]methyl N-[2-(3-chlorophenyl)-4-fluorophenyl]carbamate.
| Compound Name | [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-1-yl]methyl N-[2-(3-chlorophenyl)-4-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 69316039 |
| Molecular Formula | C23H27ClFN2O2+ |
| Molecular Weight | 417.93 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-1-yl]methyl N-[2-(3-chlorophenyl)-4-fluorophenyl]carbamate |
| SMILES | C[N+]1(C)[C@@H]2CCC[C@@]1(COC(=O)Nc1ccc(F)cc1-c1cccc(Cl)c1)CC2 |
| InChI | InChI=1S/C23H26ClFN2O2/c1-27(2)19-7-4-11-23(27,12-10-19)15-29-22(28)26-21-9-8-18(25)14-20(21)16-5-3-6-17(24)13-16/h3,5-6,8-9,13-14,19H,4,7,10-12,15H2,1-2H3/p+1/t19-,23+/m1/s1 |
| InChIKey | JDMKWKMZWWLMMQ-XXBNENTESA-O |
| XLogP | 5.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.93 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|