C20H16ClFN2O4S — CID 176652448
N-[2-[4-(3-chlorophenoxy)-3-sulfamoylphenyl]-4-fluorophenyl]acetamide (PubChem CID 176652448) has the molecular formula C20H16ClFN2O4S and a molecular weight of 434.88 g/mol. Its IUPAC name is N-[2-[4-(3-chlorophenoxy)-3-sulfamoylphenyl]-4-fluorophenyl]acetamide.
| Compound Name | N-[2-[4-(3-chlorophenoxy)-3-sulfamoylphenyl]-4-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 176652448 |
| Molecular Formula | C20H16ClFN2O4S |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | N-[2-[4-(3-chlorophenoxy)-3-sulfamoylphenyl]-4-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(F)cc1-c1ccc(Oc2cccc(Cl)c2)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C20H16ClFN2O4S/c1-12(25)24-18-7-6-15(22)11-17(18)13-5-8-19(20(9-13)29(23,26)27)28-16-4-2-3-14(21)10-16/h2-11H,1H3,(H,24,25)(H2,23,26,27) |
| InChIKey | OJQAKKOXXSCSHX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |