C19H12Cl2N2O4S — CID 21487309
2,4-bis(3-chlorophenoxy)-5-cyanobenzenesulfonamide (PubChem CID 21487309) has the molecular formula C19H12Cl2N2O4S and a molecular weight of 435.29 g/mol. Its IUPAC name is 2,4-bis(3-chlorophenoxy)-5-cyanobenzenesulfonamide.
| Compound Name | 2,4-bis(3-chlorophenoxy)-5-cyanobenzenesulfonamide |
|---|---|
| PubChem CID | 21487309 |
| Molecular Formula | C19H12Cl2N2O4S |
| Molecular Weight | 435.29 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | 2,4-bis(3-chlorophenoxy)-5-cyanobenzenesulfonamide |
| SMILES | N#Cc1cc(S(N)(=O)=O)c(Oc2cccc(Cl)c2)cc1Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H12Cl2N2O4S/c20-13-3-1-5-15(8-13)26-17-10-18(27-16-6-2-4-14(21)9-16)19(28(23,24)25)7-12(17)11-22/h1-10H,(H2,23,24,25) |
| InChIKey | PVFKKZKQKZVYFS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.29 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |