C13H11ClNO7S2- — CID 21312252
2-chloro-4-(3-methoxyphenoxy)-5-sulfamoylbenzenesulfonate (PubChem CID 21312252) has the molecular formula C13H11ClNO7S2- and a molecular weight of 392.82 g/mol. Its IUPAC name is 2-chloro-4-(3-methoxyphenoxy)-5-sulfamoylbenzenesulfonate.
| Compound Name | 2-chloro-4-(3-methoxyphenoxy)-5-sulfamoylbenzenesulfonate |
|---|---|
| PubChem CID | 21312252 |
| Molecular Formula | C13H11ClNO7S2- |
| Molecular Weight | 392.82 g/mol |
| Exact Mass | 391.97 |
| IUPAC Name | 2-chloro-4-(3-methoxyphenoxy)-5-sulfamoylbenzenesulfonate |
| SMILES | COc1cccc(Oc2cc(Cl)c(S(=O)(=O)[O-])cc2S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H12ClNO7S2/c1-21-8-3-2-4-9(5-8)22-11-6-10(14)12(24(18,19)20)7-13(11)23(15,16)17/h2-7H,1H3,(H2,15,16,17)(H,18,19,20)/p-1 |
| InChIKey | KWTDKDAODGDEMI-UHFFFAOYSA-M |
| XLogP | 1.69 |
| TPSA | 135.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.82 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|