4-(3-methoxyphenoxy)benzenesulfonyl chloride

C13H11ClO4S — CID 18071781

IUPAC4-(3-methoxyphenoxy)benzenesulfonyl chloride
SMILESCOc1cccc(Oc2ccc(S(=O)(=O)Cl)cc2)c1
InChIInChI=1S/C13H11ClO4S/c1-17-11-3-2-4-12(9-11)18-10-5-7-13(8-6-10)19(14,15)16/h2-9H,1H3
InChIKeyMDHNKJPFGSGTBP-UHFFFAOYSA-N
MW298.75 g/mol
LogP3.41
Rot. Bonds4

About 4-(3-methoxyphenoxy)benzenesulfonyl chloride

4-(3-methoxyphenoxy)benzenesulfonyl chloride (PubChem CID 18071781) has the molecular formula C13H11ClO4S and a molecular weight of 298.75 g/mol. Its IUPAC name is 4-(3-methoxyphenoxy)benzenesulfonyl chloride.

Molecular Properties

Compound Name4-(3-methoxyphenoxy)benzenesulfonyl chloride
PubChem CID18071781
Molecular FormulaC13H11ClO4S
Molecular Weight298.75 g/mol
Exact Mass298.01
IUPAC Name4-(3-methoxyphenoxy)benzenesulfonyl chloride
SMILESCOc1cccc(Oc2ccc(S(=O)(=O)Cl)cc2)c1
InChIInChI=1S/C13H11ClO4S/c1-17-11-3-2-4-12(9-11)18-10-5-7-13(8-6-10)19(14,15)16/h2-9H,1H3
InChIKeyMDHNKJPFGSGTBP-UHFFFAOYSA-N
XLogP3.41
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.75
LogP ≤ 53.41
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 4-(3-methoxyphenoxy)benzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-methoxyphenoxy)benzenesulfonyl chloride?
The IUPAC name of 4-(3-methoxyphenoxy)benzenesulfonyl chloride (CID 18071781) is 4-(3-methoxyphenoxy)benzenesulfonyl chloride.
What is the SMILES notation for 4-(3-methoxyphenoxy)benzenesulfonyl chloride?
The canonical SMILES for 4-(3-methoxyphenoxy)benzenesulfonyl chloride is COc1cccc(Oc2ccc(S(=O)(=O)Cl)cc2)c1.
What is the InChIKey of 4-(3-methoxyphenoxy)benzenesulfonyl chloride?
The InChIKey is MDHNKJPFGSGTBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClO4S/c1-17-11-3-2-4-12(9-11)18-10-5-7-13(8-6-10)19(14,15)16/h2-9H,1H3.
What are the key properties of 4-(3-methoxyphenoxy)benzenesulfonyl chloride?
4-(3-methoxyphenoxy)benzenesulfonyl chloride has a molecular weight of 298.75 g/mol, XLogP of 3.41, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methoxyphenoxy)benzenesulfonyl chloride is sourced from PubChem (CID 18071781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).