C15H16O4 — CID 95561214
1,4-dimethoxy-2-(3-methoxyphenoxy)benzene (PubChem CID 95561214) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 1,4-dimethoxy-2-(3-methoxyphenoxy)benzene.
| Compound Name | 1,4-dimethoxy-2-(3-methoxyphenoxy)benzene |
|---|---|
| PubChem CID | 95561214 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1,4-dimethoxy-2-(3-methoxyphenoxy)benzene |
| SMILES | COc1cccc(Oc2cc(OC)ccc2OC)c1 |
| InChI | InChI=1S/C15H16O4/c1-16-11-5-4-6-13(9-11)19-15-10-12(17-2)7-8-14(15)18-3/h4-10H,1-3H3 |
| InChIKey | HDAMMZDTTFMYAG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |