C14H14N2O3 — CID 70565966
1,4-dimethoxy-2-phenoxybenzene;molecular nitrogen (PubChem CID 70565966) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 1,4-dimethoxy-2-phenoxybenzene;molecular nitrogen.
| Compound Name | 1,4-dimethoxy-2-phenoxybenzene;molecular nitrogen |
|---|---|
| PubChem CID | 70565966 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1,4-dimethoxy-2-phenoxybenzene;molecular nitrogen |
| SMILES | COc1ccc(OC)c(Oc2ccccc2)c1.N#N |
| InChI | InChI=1S/C14H14O3.N2/c1-15-12-8-9-13(16-2)14(10-12)17-11-6-4-3-5-7-11;1-2/h3-10H,1-2H3; |
| InChIKey | POXFAMVFUISMNU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 75.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|