C12H12O3S — CID 91307628
2-(2,5-dimethoxyphenoxy)thiophene (PubChem CID 91307628) has the molecular formula C12H12O3S and a molecular weight of 236.29 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenoxy)thiophene.
| Compound Name | 2-(2,5-dimethoxyphenoxy)thiophene |
|---|---|
| PubChem CID | 91307628 |
| Molecular Formula | C12H12O3S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 2-(2,5-dimethoxyphenoxy)thiophene |
| SMILES | COc1ccc(OC)c(Oc2cccs2)c1 |
| InChI | InChI=1S/C12H12O3S/c1-13-9-5-6-10(14-2)11(8-9)15-12-4-3-7-16-12/h3-8H,1-2H3 |
| InChIKey | ASGVJYCDNQODSS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |