C8H11NO3 — CID 117273124
O-(2,5-dimethoxyphenyl)hydroxylamine (PubChem CID 117273124) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is O-(2,5-dimethoxyphenyl)hydroxylamine.
| Compound Name | O-(2,5-dimethoxyphenyl)hydroxylamine |
|---|---|
| PubChem CID | 117273124 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | O-(2,5-dimethoxyphenyl)hydroxylamine |
| SMILES | COc1ccc(OC)c(ON)c1 |
| InChI | InChI=1S/C8H11NO3/c1-10-6-3-4-7(11-2)8(5-6)12-9/h3-5H,9H2,1-2H3 |
| InChIKey | XWMQUFLAVWELDA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|