C7H5ClN2O2S — CID 43243622
5-chloro-2-cyanobenzenesulfonamide (PubChem CID 43243622) has the molecular formula C7H5ClN2O2S and a molecular weight of 216.65 g/mol. Its IUPAC name is 5-chloro-2-cyanobenzenesulfonamide.
| Compound Name | 5-chloro-2-cyanobenzenesulfonamide |
|---|---|
| PubChem CID | 43243622 |
| Molecular Formula | C7H5ClN2O2S |
| Molecular Weight | 216.65 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | 5-chloro-2-cyanobenzenesulfonamide |
| SMILES | N#Cc1ccc(Cl)cc1S(N)(=O)=O |
| InChI | InChI=1S/C7H5ClN2O2S/c8-6-2-1-5(4-9)7(3-6)13(10,11)12/h1-3H,(H2,10,11,12) |
| InChIKey | WRLACKZDIZSPNI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.65 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |