About azane;2-cyano-5-hydroxybenzenesulfonamide
azane;2-cyano-5-hydroxybenzenesulfonamide (PubChem CID 174596934) has the molecular formula C7H9N3O3S
and a molecular weight of 215.23 g/mol. Its IUPAC name is azane;2-cyano-5-hydroxybenzenesulfonamide.
Molecular Properties
| Compound Name | azane;2-cyano-5-hydroxybenzenesulfonamide |
| PubChem CID | 174596934 |
| Molecular Formula | C7H9N3O3S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | azane;2-cyano-5-hydroxybenzenesulfonamide |
| SMILES | N.N#Cc1ccc(O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C7H6N2O3S.H3N/c8-4-5-1-2-6(10)3-7(5)13(9,11)12;/h1-3,10H,(H2,9,11,12);1H3 |
| InChIKey | BFTAZPBUZKYNAY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze azane;2-cyano-5-hydroxybenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-cyano-5-hydroxybenzenesulfonamide?
The IUPAC name of azane;2-cyano-5-hydroxybenzenesulfonamide (CID 174596934) is azane;2-cyano-5-hydroxybenzenesulfonamide.
What is the SMILES notation for azane;2-cyano-5-hydroxybenzenesulfonamide?
The canonical SMILES for azane;2-cyano-5-hydroxybenzenesulfonamide is N.N#Cc1ccc(O)cc1S(N)(=O)=O.
What is the InChIKey of azane;2-cyano-5-hydroxybenzenesulfonamide?
The InChIKey is BFTAZPBUZKYNAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O3S.H3N/c8-4-5-1-2-6(10)3-7(5)13(9,11)12;/h1-3,10H,(H2,9,11,12);1H3.
What are the key properties of azane;2-cyano-5-hydroxybenzenesulfonamide?
azane;2-cyano-5-hydroxybenzenesulfonamide has a molecular weight of 215.23 g/mol, XLogP of 0.07, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-cyano-5-hydroxybenzenesulfonamide is sourced from PubChem (CID 174596934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).