C11H13ClN2O3S — CID 54879174
5-chloro-2-cyano-N-ethyl-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 54879174) has the molecular formula C11H13ClN2O3S and a molecular weight of 288.76 g/mol. Its IUPAC name is 5-chloro-2-cyano-N-ethyl-N-(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 5-chloro-2-cyano-N-ethyl-N-(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 54879174 |
| Molecular Formula | C11H13ClN2O3S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 5-chloro-2-cyano-N-ethyl-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | CCN(CCO)S(=O)(=O)c1cc(Cl)ccc1C#N |
| InChI | InChI=1S/C11H13ClN2O3S/c1-2-14(5-6-15)18(16,17)11-7-10(12)4-3-9(11)8-13/h3-4,7,15H,2,5-6H2,1H3 |
| InChIKey | DYBXNNDVSSHMJA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |