C12H13ClN2O4S — CID 43245320
4-[(5-chloro-2-cyanophenyl)sulfonyl-methylamino]butanoic acid (PubChem CID 43245320) has the molecular formula C12H13ClN2O4S and a molecular weight of 316.77 g/mol. Its IUPAC name is 4-[(5-chloro-2-cyanophenyl)sulfonyl-methylamino]butanoic acid.
| Compound Name | 4-[(5-chloro-2-cyanophenyl)sulfonyl-methylamino]butanoic acid |
|---|---|
| PubChem CID | 43245320 |
| Molecular Formula | C12H13ClN2O4S |
| Molecular Weight | 316.77 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 4-[(5-chloro-2-cyanophenyl)sulfonyl-methylamino]butanoic acid |
| SMILES | CN(CCCC(=O)O)S(=O)(=O)c1cc(Cl)ccc1C#N |
| InChI | InChI=1S/C12H13ClN2O4S/c1-15(6-2-3-12(16)17)20(18,19)11-7-10(13)5-4-9(11)8-14/h4-5,7H,2-3,6H2,1H3,(H,16,17) |
| InChIKey | CPBFWIMGPDXLQH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.77 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |