C11H13Cl2NO4S — CID 43235943
4-[(2,5-dichlorophenyl)sulfonyl-methylamino]butanoic acid (PubChem CID 43235943) has the molecular formula C11H13Cl2NO4S and a molecular weight of 326.20 g/mol. Its IUPAC name is 4-[(2,5-dichlorophenyl)sulfonyl-methylamino]butanoic acid.
| Compound Name | 4-[(2,5-dichlorophenyl)sulfonyl-methylamino]butanoic acid |
|---|---|
| PubChem CID | 43235943 |
| Molecular Formula | C11H13Cl2NO4S |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 4-[(2,5-dichlorophenyl)sulfonyl-methylamino]butanoic acid |
| SMILES | CN(CCCC(=O)O)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H13Cl2NO4S/c1-14(6-2-3-11(15)16)19(17,18)10-7-8(12)4-5-9(10)13/h4-5,7H,2-3,6H2,1H3,(H,15,16) |
| InChIKey | CHJOWKSPNMZQBE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |