C17H17Cl2NO5S — CID 50891450
4-(N-(2,5-dichlorophenyl)sulfonyl-4-methoxyanilino)butanoic acid (PubChem CID 50891450) has the molecular formula C17H17Cl2NO5S and a molecular weight of 418.30 g/mol. Its IUPAC name is 4-(N-(2,5-dichlorophenyl)sulfonyl-4-methoxyanilino)butanoic acid.
| Compound Name | 4-(N-(2,5-dichlorophenyl)sulfonyl-4-methoxyanilino)butanoic acid |
|---|---|
| PubChem CID | 50891450 |
| Molecular Formula | C17H17Cl2NO5S |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | 4-(N-(2,5-dichlorophenyl)sulfonyl-4-methoxyanilino)butanoic acid |
| SMILES | COc1ccc(N(CCCC(=O)O)S(=O)(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H17Cl2NO5S/c1-25-14-7-5-13(6-8-14)20(10-2-3-17(21)22)26(23,24)16-11-12(18)4-9-15(16)19/h4-9,11H,2-3,10H2,1H3,(H,21,22) |
| InChIKey | HUJIJUGJVBATGO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |