C17H17Cl2NO4S — CID 50892137
3-(N-(2,5-dichlorophenyl)sulfonyl-2,6-dimethylanilino)propanoic acid (PubChem CID 50892137) has the molecular formula C17H17Cl2NO4S and a molecular weight of 402.30 g/mol. Its IUPAC name is 3-(N-(2,5-dichlorophenyl)sulfonyl-2,6-dimethylanilino)propanoic acid.
| Compound Name | 3-(N-(2,5-dichlorophenyl)sulfonyl-2,6-dimethylanilino)propanoic acid |
|---|---|
| PubChem CID | 50892137 |
| Molecular Formula | C17H17Cl2NO4S |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 3-(N-(2,5-dichlorophenyl)sulfonyl-2,6-dimethylanilino)propanoic acid |
| SMILES | Cc1cccc(C)c1N(CCC(=O)O)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H17Cl2NO4S/c1-11-4-3-5-12(2)17(11)20(9-8-16(21)22)25(23,24)15-10-13(18)6-7-14(15)19/h3-7,10H,8-9H2,1-2H3,(H,21,22) |
| InChIKey | NCBJSLBJBRBPQA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |