C19H19ClF3NO5S — CID 5013124
ethyl 3-(N-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-4-methoxyanilino)propanoate (PubChem CID 5013124) has the molecular formula C19H19ClF3NO5S and a molecular weight of 465.88 g/mol. Its IUPAC name is ethyl 3-(N-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-4-methoxyanilino)propanoate.
| Compound Name | ethyl 3-(N-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-4-methoxyanilino)propanoate |
|---|---|
| PubChem CID | 5013124 |
| Molecular Formula | C19H19ClF3NO5S |
| Molecular Weight | 465.88 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | ethyl 3-(N-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-4-methoxyanilino)propanoate |
| SMILES | CCOC(=O)CCN(c1ccc(OC)cc1)S(=O)(=O)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C19H19ClF3NO5S/c1-3-29-18(25)10-11-24(14-5-7-15(28-2)8-6-14)30(26,27)17-12-13(19(21,22)23)4-9-16(17)20/h4-9,12H,3,10-11H2,1-2H3 |
| InChIKey | FQHPBPVFIKYBBI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.88 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |