C17H14Cl2F3NO4S — CID 50893211
ethyl 2-[N-(3,4-dichlorophenyl)sulfonyl-3-(trifluoromethyl)anilino]acetate (PubChem CID 50893211) has the molecular formula C17H14Cl2F3NO4S and a molecular weight of 456.27 g/mol. Its IUPAC name is ethyl 2-[N-(3,4-dichlorophenyl)sulfonyl-3-(trifluoromethyl)anilino]acetate.
| Compound Name | ethyl 2-[N-(3,4-dichlorophenyl)sulfonyl-3-(trifluoromethyl)anilino]acetate |
|---|---|
| PubChem CID | 50893211 |
| Molecular Formula | C17H14Cl2F3NO4S |
| Molecular Weight | 456.27 g/mol |
| Exact Mass | 455.00 |
| IUPAC Name | ethyl 2-[N-(3,4-dichlorophenyl)sulfonyl-3-(trifluoromethyl)anilino]acetate |
| SMILES | CCOC(=O)CN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2F3NO4S/c1-2-27-16(24)10-23(12-5-3-4-11(8-12)17(20,21)22)28(25,26)13-6-7-14(18)15(19)9-13/h3-9H,2,10H2,1H3 |
| InChIKey | YWQDCVQNXBKFBM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.27 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |