C15H12Cl2INO4S — CID 50891171
methyl 2-(N-(3,4-dichlorophenyl)sulfonyl-3-iodoanilino)acetate (PubChem CID 50891171) has the molecular formula C15H12Cl2INO4S and a molecular weight of 500.14 g/mol. Its IUPAC name is methyl 2-(N-(3,4-dichlorophenyl)sulfonyl-3-iodoanilino)acetate.
| Compound Name | methyl 2-(N-(3,4-dichlorophenyl)sulfonyl-3-iodoanilino)acetate |
|---|---|
| PubChem CID | 50891171 |
| Molecular Formula | C15H12Cl2INO4S |
| Molecular Weight | 500.14 g/mol |
| Exact Mass | 498.89 |
| IUPAC Name | methyl 2-(N-(3,4-dichlorophenyl)sulfonyl-3-iodoanilino)acetate |
| SMILES | COC(=O)CN(c1cccc(I)c1)S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H12Cl2INO4S/c1-23-15(20)9-19(11-4-2-3-10(18)7-11)24(21,22)12-5-6-13(16)14(17)8-12/h2-8H,9H2,1H3 |
| InChIKey | QNPMRPUDHNKVKV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.14 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|