C16H15Cl2NO4S — CID 50889582
4-(N-(3,4-dichlorophenyl)sulfonylanilino)butanoic acid (PubChem CID 50889582) has the molecular formula C16H15Cl2NO4S and a molecular weight of 388.27 g/mol. Its IUPAC name is 4-(N-(3,4-dichlorophenyl)sulfonylanilino)butanoic acid.
| Compound Name | 4-(N-(3,4-dichlorophenyl)sulfonylanilino)butanoic acid |
|---|---|
| PubChem CID | 50889582 |
| Molecular Formula | C16H15Cl2NO4S |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 4-(N-(3,4-dichlorophenyl)sulfonylanilino)butanoic acid |
| SMILES | O=C(O)CCCN(c1ccccc1)S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H15Cl2NO4S/c17-14-9-8-13(11-15(14)18)24(22,23)19(10-4-7-16(20)21)12-5-2-1-3-6-12/h1-3,5-6,8-9,11H,4,7,10H2,(H,20,21) |
| InChIKey | LJJAHRLJSKICSW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |