C18H19Cl2NO4S — CID 50891674
4-(N-(3,4-dichlorophenyl)sulfonyl-2,5-dimethylanilino)butanoic acid (PubChem CID 50891674) has the molecular formula C18H19Cl2NO4S and a molecular weight of 416.33 g/mol. Its IUPAC name is 4-(N-(3,4-dichlorophenyl)sulfonyl-2,5-dimethylanilino)butanoic acid.
| Compound Name | 4-(N-(3,4-dichlorophenyl)sulfonyl-2,5-dimethylanilino)butanoic acid |
|---|---|
| PubChem CID | 50891674 |
| Molecular Formula | C18H19Cl2NO4S |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 4-(N-(3,4-dichlorophenyl)sulfonyl-2,5-dimethylanilino)butanoic acid |
| SMILES | Cc1ccc(C)c(N(CCCC(=O)O)S(=O)(=O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H19Cl2NO4S/c1-12-5-6-13(2)17(10-12)21(9-3-4-18(22)23)26(24,25)14-7-8-15(19)16(20)11-14/h5-8,10-11H,3-4,9H2,1-2H3,(H,22,23) |
| InChIKey | YBRAHKLXPAFVIT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |