C12H16ClNO4S — CID 69317552
5-[(2-chlorophenyl)sulfonyl-methylamino]pentanoic acid (PubChem CID 69317552) has the molecular formula C12H16ClNO4S and a molecular weight of 305.78 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)sulfonyl-methylamino]pentanoic acid.
| Compound Name | 5-[(2-chlorophenyl)sulfonyl-methylamino]pentanoic acid |
|---|---|
| PubChem CID | 69317552 |
| Molecular Formula | C12H16ClNO4S |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 5-[(2-chlorophenyl)sulfonyl-methylamino]pentanoic acid |
| SMILES | CN(CCCCC(=O)O)S(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C12H16ClNO4S/c1-14(9-5-4-8-12(15)16)19(17,18)11-7-3-2-6-10(11)13/h2-3,6-7H,4-5,8-9H2,1H3,(H,15,16) |
| InChIKey | YUSTVHFKLDHDNM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|