C13H15ClN2O4S — CID 82846463
5-[(5-chloro-2-cyanophenyl)sulfonylamino]hexanoic acid (PubChem CID 82846463) has the molecular formula C13H15ClN2O4S and a molecular weight of 330.79 g/mol. Its IUPAC name is 5-[(5-chloro-2-cyanophenyl)sulfonylamino]hexanoic acid.
| Compound Name | 5-[(5-chloro-2-cyanophenyl)sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 82846463 |
| Molecular Formula | C13H15ClN2O4S |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 5-[(5-chloro-2-cyanophenyl)sulfonylamino]hexanoic acid |
| SMILES | CC(CCCC(=O)O)NS(=O)(=O)c1cc(Cl)ccc1C#N |
| InChI | InChI=1S/C13H15ClN2O4S/c1-9(3-2-4-13(17)18)16-21(19,20)12-7-11(14)6-5-10(12)8-15/h5-7,9,16H,2-4H2,1H3,(H,17,18) |
| InChIKey | MYNXVSPGVMVUQF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |