C12H15ClN2O3S — CID 79255611
5-chloro-2-cyano-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]benzenesulfonamide (PubChem CID 79255611) has the molecular formula C12H15ClN2O3S and a molecular weight of 302.78 g/mol. Its IUPAC name is 5-chloro-2-cyano-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]benzenesulfonamide.
| Compound Name | 5-chloro-2-cyano-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 79255611 |
| Molecular Formula | C12H15ClN2O3S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 5-chloro-2-cyano-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]benzenesulfonamide |
| SMILES | CC(C)[C@@H](CO)NS(=O)(=O)c1cc(Cl)ccc1C#N |
| InChI | InChI=1S/C12H15ClN2O3S/c1-8(2)11(7-16)15-19(17,18)12-5-10(13)4-3-9(12)6-14/h3-5,8,11,15-16H,7H2,1-2H3/t11-/m1/s1 |
| InChIKey | UTVKPCWVMKIRHF-LLVKDONJSA-N |
| XLogP | 1.51 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |